C15H19ClFN3 — CID 111456383
N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111456383) has the molecular formula C15H19ClFN3 and a molecular weight of 295.79 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111456383 |
| Molecular Formula | C15H19ClFN3 |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NC1CC1c1c(F)cccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C15H19ClFN3/c1-18-15(20-7-2-3-8-20)19-13-9-10(13)14-11(16)5-4-6-12(14)17/h4-6,10,13H,2-3,7-9H2,1H3,(H,18,19) |
| InChIKey | ICHKSFRIESVXSI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|