C11H14F2IN3 — CID 119147959
1-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine;hydroiodide (PubChem CID 119147959) has the molecular formula C11H14F2IN3 and a molecular weight of 353.15 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119147959 |
| Molecular Formula | C11H14F2IN3 |
| Molecular Weight | 353.15 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\N)NC1CC1c1c(F)cccc1F.I |
| InChI | InChI=1S/C11H13F2N3.HI/c1-15-11(14)16-9-5-6(9)10-7(12)3-2-4-8(10)13;/h2-4,6,9H,5H2,1H3,(H3,14,15,16);1H |
| InChIKey | GLGDPUIXBKXFON-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|