C15H19F2N3O2S — CID 111792282
1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111792282) has the molecular formula C15H19F2N3O2S and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111792282 |
| Molecular Formula | C15H19F2N3O2S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(/NC1CCS(=O)(=O)C1)NC1CC1c1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2N3O2S/c1-18-15(19-9-5-6-23(21,22)8-9)20-13-7-10(13)14-11(16)3-2-4-12(14)17/h2-4,9-10,13H,5-8H2,1H3,(H2,18,19,20) |
| InChIKey | SYCPIXJPWKUYDB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|