C15H21F2N3 — CID 111792647
1-butyl-3-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine (PubChem CID 111792647) has the molecular formula C15H21F2N3 and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-butyl-3-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine.
| Compound Name | 1-butyl-3-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111792647 |
| Molecular Formula | C15H21F2N3 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-butyl-3-[2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine |
| SMILES | CCCCN/C(=N\C)NC1CC1c1c(F)cccc1F |
| InChI | InChI=1S/C15H21F2N3/c1-3-4-8-19-15(18-2)20-13-9-10(13)14-11(16)6-5-7-12(14)17/h5-7,10,13H,3-4,8-9H2,1-2H3,(H2,18,19,20) |
| InChIKey | HCSMSVDQTXTKBL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|