C19H20F3N3 — CID 111794086
1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111794086) has the molecular formula C19H20F3N3 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111794086 |
| Molecular Formula | C19H20F3N3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NC1CC1c1c(F)cccc1F |
| InChI | InChI=1S/C19H20F3N3/c1-23-19(24-10-9-12-5-7-13(20)8-6-12)25-17-11-14(17)18-15(21)3-2-4-16(18)22/h2-8,14,17H,9-11H2,1H3,(H2,23,24,25) |
| InChIKey | UTVIZOBOSKIALQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|