C20H23F3IN3O2S — CID 109445048
1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109445048) has the molecular formula C20H23F3IN3O2S and a molecular weight of 553.39 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109445048 |
| Molecular Formula | C20H23F3IN3O2S |
| Molecular Weight | 553.39 g/mol |
| Exact Mass | 553.05 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)cyclopropyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(F)ccc1CS(C)(=O)=O)NC1CC1c1c(F)cccc1F.I |
| InChI | InChI=1S/C20H22F3N3O2S.HI/c1-24-20(26-18-9-15(18)19-16(22)4-3-5-17(19)23)25-10-13-8-14(21)7-6-12(13)11-29(2,27)28;/h3-8,15,18H,9-11H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | CMULTSZHSMAFQH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|