C19H31FIN3O3S — CID 109445916
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methylguanidine;hydroiodide (PubChem CID 109445916) has the molecular formula C19H31FIN3O3S and a molecular weight of 527.44 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109445916 |
| Molecular Formula | C19H31FIN3O3S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(F)ccc1CS(C)(=O)=O)NC1CC(C)(OC)C1(C)C.I |
| InChI | InChI=1S/C19H30FN3O3S.HI/c1-18(2)16(10-19(18,3)26-5)23-17(21-4)22-11-14-9-15(20)8-7-13(14)12-27(6,24)25;/h7-9,16H,10-12H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | NASBPRWVSFYZRO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|