C11H13F2N3 — CID 122082415
1-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine (PubChem CID 122082415) has the molecular formula C11H13F2N3 and a molecular weight of 225.24 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine.
| Compound Name | 1-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 122082415 |
| Molecular Formula | C11H13F2N3 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-[(1R,2S)-2-(2,6-difluorophenyl)cyclopropyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@@H]1C[C@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2N3/c1-15-11(14)16-9-5-6(9)10-7(12)3-2-4-8(10)13/h2-4,6,9H,5H2,1H3,(H3,14,15,16)/t6-,9-/m1/s1 |
| InChIKey | WEHXZQMDPFMSRG-HZGVNTEJSA-N |
| XLogP | 1.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|