C11H14FN3 — CID 122082343
1-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-methylguanidine (PubChem CID 122082343) has the molecular formula C11H14FN3 and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-methylguanidine.
| Compound Name | 1-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 122082343 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 1-[(1R,2S)-2-(3-fluorophenyl)cyclopropyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@@H]1C[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C11H14FN3/c1-14-11(13)15-10-6-9(10)7-3-2-4-8(12)5-7/h2-5,9-10H,6H2,1H3,(H3,13,14,15)/t9-,10+/m0/s1 |
| InChIKey | VIHNSAPCPFFAAF-VHSXEESVSA-N |
| XLogP | 1.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|