C14H14FNO3 — CID 129380118
1-[[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 129380118) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-[[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 129380118 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-[[(1R,2R)-2-(3-fluorophenyl)cyclopropyl]carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)N[C@@H]2C[C@@H]2c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C14H14FNO3/c15-9-3-1-2-8(6-9)10-7-11(10)16-12(17)14(4-5-14)13(18)19/h1-3,6,10-11H,4-5,7H2,(H,16,17)(H,18,19)/t10-,11-/m1/s1 |
| InChIKey | IEKPRKTUZZLXOF-GHMZBOCLSA-N |
| XLogP | 1.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|