C19H23F2N3O — CID 119160750
N-[2-(2,6-difluorophenyl)cyclopropyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119160750) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)cyclopropyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N-[2-(2,6-difluorophenyl)cyclopropyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119160750 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)cyclopropyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | C/N=C(/NC1CC1c1c(F)cccc1F)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C19H23F2N3O/c1-22-19(24-8-11-12(9-24)17-6-5-16(11)25-17)23-15-7-10(15)18-13(20)3-2-4-14(18)21/h2-4,10-12,15-17H,5-9H2,1H3,(H,22,23) |
| InChIKey | IDDCMNIAKVHJGG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|