C19H22ClFN6O — CID 109434353
N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109434353) has the molecular formula C19H22ClFN6O and a molecular weight of 404.88 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109434353 |
| Molecular Formula | C19H22ClFN6O |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)cyclopropyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(/NC1CC1c1c(F)cccc1Cl)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C19H22ClFN6O/c1-22-19(24-16-8-13(16)18-14(20)4-3-5-15(18)21)26-6-7-27(17(28)11-26)12-9-23-25(2)10-12/h3-5,9-10,13,16H,6-8,11H2,1-2H3,(H,22,24) |
| InChIKey | NXZLUZWSTCZRNS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|