C18H30N6O2 — CID 109435377
N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109435377) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109435377 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(/NC1CC(C)(OC)C1(C)C)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H30N6O2/c1-17(2)14(9-18(17,3)26-6)21-16(19-4)23-7-8-24(15(25)12-23)13-10-20-22(5)11-13/h10-11,14H,7-9,12H2,1-6H3,(H,19,21) |
| InChIKey | QQMZJJDSSZUADY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|