C18H29N7O2 — CID 109436435
N-cyclohexyl-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide (PubChem CID 109436435) has the molecular formula C18H29N7O2 and a molecular weight of 375.48 g/mol. Its IUPAC name is N-cyclohexyl-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 109436435 |
| Molecular Formula | C18H29N7O2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N-cyclohexyl-2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC1CCCCC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H29N7O2/c1-19-18(20-11-16(26)22-14-6-4-3-5-7-14)24-8-9-25(17(27)13-24)15-10-21-23(2)12-15/h10,12,14H,3-9,11,13H2,1-2H3,(H,19,20)(H,22,26) |
| InChIKey | SIZOTDDCKOLVGI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|