C21H28N6O — CID 109433853
N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(1-phenylcyclobutyl)methyl]piperazine-1-carboximidamide (PubChem CID 109433853) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(1-phenylcyclobutyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(1-phenylcyclobutyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109433853 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxo-N-[(1-phenylcyclobutyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(c2ccccc2)CCC1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C21H28N6O/c1-22-20(23-16-21(9-6-10-21)17-7-4-3-5-8-17)26-11-12-27(19(28)15-26)18-13-24-25(2)14-18/h3-5,7-8,13-14H,6,9-12,15-16H2,1-2H3,(H,22,23) |
| InChIKey | GUGKNVJQIYKWDA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|