C19H32IN7O2 — CID 109433190
N,N-dimethyl-1-[[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide (PubChem CID 109433190) has the molecular formula C19H32IN7O2 and a molecular weight of 517.42 g/mol. Its IUPAC name is N,N-dimethyl-1-[[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide.
| Compound Name | N,N-dimethyl-1-[[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109433190 |
| Molecular Formula | C19H32IN7O2 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N,N-dimethyl-1-[[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCC1(C(=O)N(C)C)CCCC1)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C19H31N7O2.HI/c1-20-18(21-14-19(7-5-6-8-19)17(28)23(2)3)25-9-10-26(16(27)13-25)15-11-22-24(4)12-15;/h11-12H,5-10,13-14H2,1-4H3,(H,20,21);1H |
| InChIKey | KDMQQTSEKILXPF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|