C17H20BrFN6O — CID 109436423
N-[(5-bromo-2-fluorophenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436423) has the molecular formula C17H20BrFN6O and a molecular weight of 423.29 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436423 |
| Molecular Formula | C17H20BrFN6O |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cc(Br)ccc1F)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C17H20BrFN6O/c1-20-17(21-8-12-7-13(18)3-4-15(12)19)24-5-6-25(16(26)11-24)14-9-22-23(2)10-14/h3-4,7,9-10H,5-6,8,11H2,1-2H3,(H,20,21) |
| InChIKey | ACPCHPILZDLMDI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|