C18H21F3IN7O2 — CID 109435516
2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 109435516) has the molecular formula C18H21F3IN7O2 and a molecular weight of 551.31 g/mol. Its IUPAC name is 2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 109435516 |
| Molecular Formula | C18H21F3IN7O2 |
| Molecular Weight | 551.31 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)c(F)c1F)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C18H20F3N7O2.HI/c1-22-18(23-8-14(29)25-13-4-3-12(19)16(20)17(13)21)27-5-6-28(15(30)10-27)11-7-24-26(2)9-11;/h3-4,7,9H,5-6,8,10H2,1-2H3,(H,22,23)(H,25,29);1H |
| InChIKey | YLBVOWZPMWNVER-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|