C20H27ClIN7O2 — CID 109434502
N-(3-chloro-2-methylphenyl)-3-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]propanamide;hydroiodide (PubChem CID 109434502) has the molecular formula C20H27ClIN7O2 and a molecular weight of 559.84 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109434502 |
| Molecular Formula | C20H27ClIN7O2 |
| Molecular Weight | 559.84 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N-methyl-C-[4-(1-methylpyrazol-4-yl)-3-oxopiperazin-1-yl]carbonimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)Nc1cccc(Cl)c1C)N1CCN(c2cnn(C)c2)C(=O)C1.I |
| InChI | InChI=1S/C20H26ClN7O2.HI/c1-14-16(21)5-4-6-17(14)25-18(29)7-8-23-20(22-2)27-9-10-28(19(30)13-27)15-11-24-26(3)12-15;/h4-6,11-12H,7-10,13H2,1-3H3,(H,22,23)(H,25,29);1H |
| InChIKey | FBMQSJGBHHZVGA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.84 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|