C18H22F2N6O2 — CID 109432563
N-[2-(3,4-difluorophenoxy)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109432563) has the molecular formula C18H22F2N6O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109432563 |
| Molecular Formula | C18H22F2N6O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCOc1ccc(F)c(F)c1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C18H22F2N6O2/c1-21-18(22-5-8-28-14-3-4-15(19)16(20)9-14)25-6-7-26(17(27)12-25)13-10-23-24(2)11-13/h3-4,9-11H,5-8,12H2,1-2H3,(H,21,22) |
| InChIKey | PDKCLWDHBREKAK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|