C17H22ClN7O2 — CID 109436291
N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide (PubChem CID 109436291) has the molecular formula C17H22ClN7O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109436291 |
| Molecular Formula | C17H22ClN7O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-N'-methyl-4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCOc1ccc(Cl)cn1)N1CCN(c2cnn(C)c2)C(=O)C1 |
| InChI | InChI=1S/C17H22ClN7O2/c1-19-17(20-5-8-27-15-4-3-13(18)9-21-15)24-6-7-25(16(26)12-24)14-10-22-23(2)11-14/h3-4,9-11H,5-8,12H2,1-2H3,(H,19,20) |
| InChIKey | FORBTQDEPLFTAJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|