C15H20BrN3O2S — CID 111142017
1-[2-(4-bromophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111142017) has the molecular formula C15H20BrN3O2S and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[2-(4-bromophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111142017 |
| Molecular Formula | C15H20BrN3O2S |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-[2-(4-bromophenyl)cyclopropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(/NC1CCS(=O)(=O)C1)NC1CC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H20BrN3O2S/c1-17-15(18-12-6-7-22(20,21)9-12)19-14-8-13(14)10-2-4-11(16)5-3-10/h2-5,12-14H,6-9H2,1H3,(H2,17,18,19) |
| InChIKey | UUXBWTPSZSVLGU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|