C11H16BrN3O2S2 — CID 111140477
1-[(4-bromothiophen-2-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111140477) has the molecular formula C11H16BrN3O2S2 and a molecular weight of 366.31 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111140477 |
| Molecular Formula | C11H16BrN3O2S2 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1cc(Br)cs1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H16BrN3O2S2/c1-13-11(14-5-10-4-8(12)6-18-10)15-9-2-3-19(16,17)7-9/h4,6,9H,2-3,5,7H2,1H3,(H2,13,14,15) |
| InChIKey | VDKHSPZGILEGQI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|