C14H19IN4O3S2 — CID 111141896
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111141896) has the molecular formula C14H19IN4O3S2 and a molecular weight of 482.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141896 |
| Molecular Formula | C14H19IN4O3S2 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2cccs2)n1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C14H18N4O3S2.HI/c1-15-14(18-10-4-6-23(19,20)9-10)16-7-11-8-21-13(17-11)12-3-2-5-22-12;/h2-3,5,8,10H,4,6-7,9H2,1H3,(H2,15,16,18);1H |
| InChIKey | QPENTBNVYCUXHO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|