C14H24IN3O2S2 — CID 111510683
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111510683) has the molecular formula C14H24IN3O2S2 and a molecular weight of 457.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111510683 |
| Molecular Formula | C14H24IN3O2S2 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)Cc1cccs1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C14H23N3O2S2.HI/c1-11(8-13-4-3-6-20-13)9-16-14(15-2)17-12-5-7-21(18,19)10-12;/h3-4,6,11-12H,5,7-10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | RSPBEIKZVUUOPO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|