C13H29IN4O2S — CID 111141756
1-[2-(diethylamino)propyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 111141756) has the molecular formula C13H29IN4O2S and a molecular weight of 432.37 g/mol. Its IUPAC name is 1-[2-(diethylamino)propyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(diethylamino)propyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111141756 |
| Molecular Formula | C13H29IN4O2S |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1-[2-(diethylamino)propyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)C(C)CN/C(=N\C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C13H28N4O2S.HI/c1-5-17(6-2)11(3)9-15-13(14-4)16-12-7-8-20(18,19)10-12;/h11-12H,5-10H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | YWADNVGUEVTOPC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|