C11H24IN3O3S — CID 111141580
1-(1,1-dioxothiolan-3-yl)-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide (PubChem CID 111141580) has the molecular formula C11H24IN3O3S and a molecular weight of 405.30 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111141580 |
| Molecular Formula | C11H24IN3O3S |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-ethoxypropyl)-2-methylguanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C11H23N3O3S.HI/c1-3-17-7-4-6-13-11(12-2)14-10-5-8-18(15,16)9-10;/h10H,3-9H2,1-2H3,(H2,12,13,14);1H |
| InChIKey | CSXSKIPAHYIGNC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|