C14H29IN4O3S — CID 111140676
1-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 111140676) has the molecular formula C14H29IN4O3S and a molecular weight of 460.38 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111140676 |
| Molecular Formula | C14H29IN4O3S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-[2-[cyclopropyl(2-methoxyethyl)amino]ethyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(CCOC)C1CC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C14H28N4O3S.HI/c1-15-14(17-12-5-10-22(19,20)11-12)16-6-7-18(8-9-21-2)13-3-4-13;/h12-13H,3-11H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | OLIBIWORTKDZAX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|