C14H28N4O4S — CID 111140721
tert-butyl N-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111140721) has the molecular formula C14H28N4O4S and a molecular weight of 348.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111140721 |
| Molecular Formula | C14H28N4O4S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | tert-butyl N-[3-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H28N4O4S/c1-14(2,3)22-13(19)17-8-5-7-16-12(15-4)18-11-6-9-23(20,21)10-11/h11H,5-10H2,1-4H3,(H,17,19)(H2,15,16,18) |
| InChIKey | JTVYWNZABOYOSH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|