C15H28N4O3S — CID 111142009
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]guanidine (PubChem CID 111142009) has the molecular formula C15H28N4O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]guanidine |
|---|---|
| PubChem CID | 111142009 |
| Molecular Formula | C15H28N4O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[3-(2-methylpiperidin-1-yl)-3-oxopropyl]guanidine |
| SMILES | C/N=C(\NCCC(=O)N1CCCCC1C)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H28N4O3S/c1-12-5-3-4-9-19(12)14(20)6-8-17-15(16-2)18-13-7-10-23(21,22)11-13/h12-13H,3-11H2,1-2H3,(H2,16,17,18) |
| InChIKey | JOFCKTXYRMQQBW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|