C17H28IN3O2S — CID 111142356
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3-methyl-2-phenylbutyl)guanidine;hydroiodide (PubChem CID 111142356) has the molecular formula C17H28IN3O2S and a molecular weight of 465.40 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3-methyl-2-phenylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3-methyl-2-phenylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111142356 |
| Molecular Formula | C17H28IN3O2S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-(3-methyl-2-phenylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccccc1)C(C)C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H27N3O2S.HI/c1-13(2)16(14-7-5-4-6-8-14)11-19-17(18-3)20-15-9-10-23(21,22)12-15;/h4-8,13,15-16H,9-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | FCAIPQBGDXELDF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|