C19H30N4O2S — CID 111140571
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]guanidine (PubChem CID 111140571) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111140571 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]guanidine |
| SMILES | C/N=C(\NCC(c1ccc(C)cc1)N1CCCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H30N4O2S/c1-15-5-7-16(8-6-15)18(23-10-3-4-11-23)13-21-19(20-2)22-17-9-12-26(24,25)14-17/h5-8,17-18H,3-4,9-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | GIBNIEYEAMMXBT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|