C21H34IN5O3S — CID 111325799
N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111325799) has the molecular formula C21H34IN5O3S and a molecular weight of 563.51 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111325799 |
| Molecular Formula | C21H34IN5O3S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)NCC(c1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C21H33N5O3S.HI/c1-22-21(23-11-9-20(27)25-18-10-14-30(28,29)16-18)24-15-19(26-12-5-6-13-26)17-7-3-2-4-8-17;/h2-4,7-8,18-19H,5-6,9-16H2,1H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | PIEOZZMTOKGGOA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|