C18H28FIN4O4S — CID 111684377
N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(2-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111684377) has the molecular formula C18H28FIN4O4S and a molecular weight of 542.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(2-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(2-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111684377 |
| Molecular Formula | C18H28FIN4O4S |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[N-[2-(2-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NC1CCS(=O)(=O)C1)NCC(C)Oc1ccccc1F.I |
| InChI | InChI=1S/C18H27FN4O4S.HI/c1-13(27-16-6-4-3-5-15(16)19)11-22-18(20-2)21-9-7-17(24)23-14-8-10-28(25,26)12-14;/h3-6,13-14H,7-12H2,1-2H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | OOCAMKIUTGWVOI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|