C16H25N3O3S — CID 111501917
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine (PubChem CID 111501917) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111501917 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(3-methylphenoxy)propyl]guanidine |
| SMILES | C/N=C(\NCC(C)Oc1cccc(C)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H25N3O3S/c1-12-5-4-6-15(9-12)22-13(2)10-18-16(17-3)19-14-7-8-23(20,21)11-14/h4-6,9,13-14H,7-8,10-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | QIBOLBHKLSEAMF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|