C13H19FIN3O2S — CID 111140210
1-(1,1-dioxothiolan-3-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111140210) has the molecular formula C13H19FIN3O2S and a molecular weight of 427.28 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111140210 |
| Molecular Formula | C13H19FIN3O2S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1F)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C13H18FN3O2S.HI/c1-15-13(17-11-6-7-20(18,19)9-11)16-8-10-4-2-3-5-12(10)14;/h2-5,11H,6-9H2,1H3,(H2,15,16,17);1H |
| InChIKey | HWOKDEKOFVQQQH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|