C17H29IN4O4S2 — CID 111141924
1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 111141924) has the molecular formula C17H29IN4O4S2 and a molecular weight of 544.48 g/mol. Its IUPAC name is 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111141924 |
| Molecular Formula | C17H29IN4O4S2 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1S(=O)(=O)NC(C)(C)C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H28N4O4S2.HI/c1-17(2,3)21-27(24,25)15-8-6-5-7-13(15)11-19-16(18-4)20-14-9-10-26(22,23)12-14;/h5-8,14,21H,9-12H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | ZNKIQZGZAXLHRS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|