C17H29IN4O2S — CID 111961234
1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide (PubChem CID 111961234) has the molecular formula C17H29IN4O2S and a molecular weight of 480.42 g/mol. Its IUPAC name is 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111961234 |
| Molecular Formula | C17H29IN4O2S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methyl-3-(2-methylcyclopropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1S(=O)(=O)NC(C)(C)C)NC1CC1C.I |
| InChI | InChI=1S/C17H28N4O2S.HI/c1-12-10-14(12)20-16(18-5)19-11-13-8-6-7-9-15(13)24(22,23)21-17(2,3)4;/h6-9,12,14,21H,10-11H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | ZOXZWULFZJGHQL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|