C17H26IN3O3S — CID 111827700
1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 111827700) has the molecular formula C17H26IN3O3S and a molecular weight of 479.38 g/mol. Its IUPAC name is 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111827700 |
| Molecular Formula | C17H26IN3O3S |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 1-[[2-(cyclopropylmethoxy)phenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OCC1CC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H25N3O3S.HI/c1-18-17(20-15-8-9-24(21,22)12-15)19-10-14-4-2-3-5-16(14)23-11-13-6-7-13;/h2-5,13,15H,6-12H2,1H3,(H2,18,19,20);1H |
| InChIKey | CCKHVSMWSJFVST-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|