C13H18FN3O3S — CID 111792342
1-(1,1-dioxothiolan-3-yl)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine (PubChem CID 111792342) has the molecular formula C13H18FN3O3S and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111792342 |
| Molecular Formula | C13H18FN3O3S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(3-fluoro-4-hydroxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(O)c(F)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18FN3O3S/c1-15-13(17-10-4-5-21(19,20)8-10)16-7-9-2-3-12(18)11(14)6-9/h2-3,6,10,18H,4-5,7-8H2,1H3,(H2,15,16,17) |
| InChIKey | FHEWCLBCEILRCC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|