C22H29N3O3S — CID 111143616
1-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine (PubChem CID 111143616) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine.
| Compound Name | 1-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111143616 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Oc2cc(C)cc(C)c2)c(C)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H29N3O3S/c1-15-9-16(2)11-20(10-15)28-21-6-5-18(12-17(21)3)13-24-22(23-4)25-19-7-8-29(26,27)14-19/h5-6,9-12,19H,7-8,13-14H2,1-4H3,(H2,23,24,25) |
| InChIKey | PNDAYLMKILCDFQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|