C15H24IN3O2S — CID 111792353
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111792353) has the molecular formula C15H24IN3O2S and a molecular weight of 437.35 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111792353 |
| Molecular Formula | C15H24IN3O2S |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-(4-methylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(C)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H23N3O2S.HI/c1-12-3-5-13(6-4-12)7-9-17-15(16-2)18-14-8-10-21(19,20)11-14;/h3-6,14H,7-11H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | PFGJXIOVWNYWDU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|