C17H22FN5O2S — CID 111142407
1-(1,1-dioxothiolan-3-yl)-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylguanidine (PubChem CID 111142407) has the molecular formula C17H22FN5O2S and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111142407 |
| Molecular Formula | C17H22FN5O2S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(-n2ccnc2C)c(F)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22FN5O2S/c1-12-20-6-7-23(12)16-4-3-13(9-15(16)18)10-21-17(19-2)22-14-5-8-26(24,25)11-14/h3-4,6-7,9,14H,5,8,10-11H2,1-2H3,(H2,19,21,22) |
| InChIKey | WLQOHIIEHAHEKA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|