C21H29FN6O2 — CID 109465820
tert-butyl 3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465820) has the molecular formula C21H29FN6O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is tert-butyl 3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465820 |
| Molecular Formula | C21H29FN6O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | tert-butyl 3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCc1ccc(-n2ccnc2C)c(F)c1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H29FN6O2/c1-14-24-8-9-28(14)18-7-6-15(10-17(18)22)11-25-19(23-5)26-16-12-27(13-16)20(29)30-21(2,3)4/h6-10,16H,11-13H2,1-5H3,(H2,23,25,26) |
| InChIKey | BZDKCSMDAUWQNW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|