C21H32FIN6O2 — CID 111886392
tert-butyl N-[3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886392) has the molecular formula C21H32FIN6O2 and a molecular weight of 546.43 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886392 |
| Molecular Formula | C21H32FIN6O2 |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | tert-butyl N-[3-[[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCc1ccc(-n2ccnc2C)c(F)c1.I |
| InChI | InChI=1S/C21H31FN6O2.HI/c1-15-24-11-12-28(15)18-8-7-16(13-17(18)22)14-27-19(23-5)25-9-6-10-26-20(29)30-21(2,3)4;/h7-8,11-13H,6,9-10,14H2,1-5H3,(H,26,29)(H2,23,25,27);1H |
| InChIKey | PYLDWYAGACJPAL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|