C22H23F4N5O — CID 111871343
1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111871343) has the molecular formula C22H23F4N5O and a molecular weight of 449.45 g/mol. Its IUPAC name is 1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111871343 |
| Molecular Formula | C22H23F4N5O |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)cc1)NCc1ccc(-n2ccnc2C)c(F)c1 |
| InChI | InChI=1S/C22H23F4N5O/c1-15-28-9-10-31(15)20-8-5-17(11-19(20)23)13-30-21(27-2)29-12-16-3-6-18(7-4-16)32-14-22(24,25)26/h3-11H,12-14H2,1-2H3,(H2,27,29,30) |
| InChIKey | IRJCGGXMLWSMQP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|