C20H27FN6O2 — CID 111164001
ethyl 4-[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111164001) has the molecular formula C20H27FN6O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is ethyl 4-[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111164001 |
| Molecular Formula | C20H27FN6O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | ethyl 4-[N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N\C)NCc2ccc(-n3ccnc3C)c(F)c2)CC1 |
| InChI | InChI=1S/C20H27FN6O2/c1-4-29-20(28)26-11-9-25(10-12-26)19(22-3)24-14-16-5-6-18(17(21)13-16)27-8-7-23-15(27)2/h5-8,13H,4,9-12,14H2,1-3H3,(H,22,24) |
| InChIKey | GTRRHVFGDDQIQP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|