C18H24FN3O2 — CID 47738765
N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-methylpropoxy)propanamide (PubChem CID 47738765) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-methylpropoxy)propanamide.
| Compound Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-methylpropoxy)propanamide |
|---|---|
| PubChem CID | 47738765 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(2-methylpropoxy)propanamide |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)CCOCC(C)C)cc1F |
| InChI | InChI=1S/C18H24FN3O2/c1-13(2)12-24-9-6-18(23)21-11-15-4-5-17(16(19)10-15)22-8-7-20-14(22)3/h4-5,7-8,10,13H,6,9,11-12H2,1-3H3,(H,21,23) |
| InChIKey | BETVHCALUWMJHS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|