C18H25FN4O2 — CID 111505315
1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-hydroxy-4-methylpentyl)urea (PubChem CID 111505315) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-hydroxy-4-methylpentyl)urea.
| Compound Name | 1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-hydroxy-4-methylpentyl)urea |
|---|---|
| PubChem CID | 111505315 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-3-(3-hydroxy-4-methylpentyl)urea |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)NCCC(O)C(C)C)cc1F |
| InChI | InChI=1S/C18H25FN4O2/c1-12(2)17(24)6-7-21-18(25)22-11-14-4-5-16(15(19)10-14)23-9-8-20-13(23)3/h4-5,8-10,12,17,24H,6-7,11H2,1-3H3,(H2,21,22,25) |
| InChIKey | FAFQUAQNJLFGGR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |