C21H20FN5O — CID 47768484
1-[1-(4-cyanophenyl)ethyl]-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]urea (PubChem CID 47768484) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-[1-(4-cyanophenyl)ethyl]-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]urea.
| Compound Name | 1-[1-(4-cyanophenyl)ethyl]-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 47768484 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[1-(4-cyanophenyl)ethyl]-3-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]urea |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)NC(C)c2ccc(C#N)cc2)cc1F |
| InChI | InChI=1S/C21H20FN5O/c1-14(18-6-3-16(12-23)4-7-18)26-21(28)25-13-17-5-8-20(19(22)11-17)27-10-9-24-15(27)2/h3-11,14H,13H2,1-2H3,(H2,25,26,28) |
| InChIKey | ANRNVACSARMPLZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |